About CID 15104222
CID 15104222 (PubChem CID 15104222) has the molecular formula C31H24NS
and a molecular weight of 442.61 g/mol.
Molecular Properties
| Compound Name | CID 15104222 |
| PubChem CID | 15104222 |
| Molecular Formula | C31H24NS |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | — |
| SMILES | Cc1ccc(S[N]c2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H24NS/c1-23-17-19-28(20-18-23)33-32-31-29(25-13-7-3-8-14-25)21-27(24-11-5-2-6-12-24)22-30(31)26-15-9-4-10-16-26/h2-22H,1H3 |
| InChIKey | NJDVZXFKGKJZBU-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 15104222 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15104222?
The IUPAC name of CID 15104222 (CID 15104222) is not available.
What is the SMILES notation for CID 15104222?
The canonical SMILES for CID 15104222 is Cc1ccc(S[N]c2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.
What is the InChIKey of CID 15104222?
The InChIKey is NJDVZXFKGKJZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24NS/c1-23-17-19-28(20-18-23)33-32-31-29(25-13-7-3-8-14-25)21-27(24-11-5-2-6-12-24)22-30(31)26-15-9-4-10-16-26/h2-22H,1H3.
What are the key properties of CID 15104222?
CID 15104222 has a molecular weight of 442.61 g/mol, XLogP of 8.94, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15104222 is sourced from PubChem (CID 15104222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).