About (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate
(2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate (PubChem CID 151042342) has the molecular formula C10H9N3O5
and a molecular weight of 251.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate |
| PubChem CID | 151042342 |
| Molecular Formula | C10H9N3O5 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate |
| SMILES | CC(=NN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C10H9N3O5/c1-6(11-12-7(14)2-3-8(12)15)18-13-9(16)4-5-10(13)17/h2-3H,4-5H2,1H3 |
| InChIKey | MCIUVTDXNKXXOQ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 96.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate (CID 151042342) is (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate is CC(=NN1C(=O)C=CC1=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate?
The InChIKey is MCIUVTDXNKXXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O5/c1-6(11-12-7(14)2-3-8(12)15)18-13-9(16)4-5-10(13)17/h2-3H,4-5H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate?
(2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate has a molecular weight of 251.20 g/mol, XLogP of -0.67, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) N-(2,5-dioxopyrrol-1-yl)ethanimidate is sourced from PubChem (CID 151042342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).