C21H39ClO6Si2 — CID 151043884
[2-(4-chloro-2-methylphenyl)-1-triethoxysilylethyl]-triethoxysilane (PubChem CID 151043884) has the molecular formula C21H39ClO6Si2 and a molecular weight of 479.16 g/mol. Its IUPAC name is [2-(4-chloro-2-methylphenyl)-1-triethoxysilylethyl]-triethoxysilane.
| Compound Name | [2-(4-chloro-2-methylphenyl)-1-triethoxysilylethyl]-triethoxysilane |
|---|---|
| PubChem CID | 151043884 |
| Molecular Formula | C21H39ClO6Si2 |
| Molecular Weight | 479.16 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | [2-(4-chloro-2-methylphenyl)-1-triethoxysilylethyl]-triethoxysilane |
| SMILES | CCO[Si](OCC)(OCC)C(Cc1ccc(Cl)cc1C)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C21H39ClO6Si2/c1-8-23-29(24-9-2,25-10-3)21(17-19-14-15-20(22)16-18(19)7)30(26-11-4,27-12-5)28-13-6/h14-16,21H,8-13,17H2,1-7H3 |
| InChIKey | MCQVLAKOGMUFGQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.16 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|