C28H35Cl2N3O2 — CID 15104599
3,4-dichloro-N-[(2R)-1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide (PubChem CID 15104599) has the molecular formula C28H35Cl2N3O2 and a molecular weight of 516.51 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2R)-1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2R)-1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 15104599 |
| Molecular Formula | C28H35Cl2N3O2 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 3,4-dichloro-N-[(2R)-1-(dipentylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]benzamide |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H35Cl2N3O2/c1-3-5-9-15-33(16-10-6-4-2)28(35)26(18-21-19-31-25-12-8-7-11-22(21)25)32-27(34)20-13-14-23(29)24(30)17-20/h7-8,11-14,17,19,26,31H,3-6,9-10,15-16,18H2,1-2H3,(H,32,34)/t26-/m1/s1 |
| InChIKey | GYKPTNGWAOXEJF-AREMUKBSSA-N |
| XLogP | 7.02 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|