C19H27F5O4 — CID 151050361
1,1-dimethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol (PubChem CID 151050361) has the molecular formula C19H27F5O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is 1,1-dimethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol.
| Compound Name | 1,1-dimethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol |
|---|---|
| PubChem CID | 151050361 |
| Molecular Formula | C19H27F5O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1,1-dimethoxy-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]decan-1-ol |
| SMILES | CCCCCCCCC(COc1c(F)c(F)c(F)c(F)c1F)C(O)(OC)OC |
| InChI | InChI=1S/C19H27F5O4/c1-4-5-6-7-8-9-10-12(19(25,26-2)27-3)11-28-18-16(23)14(21)13(20)15(22)17(18)24/h12,25H,4-11H2,1-3H3 |
| InChIKey | MDZMFHRAPKFATH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|