C16H30BN3O5 — CID 151050988
(3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-methylbutanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid (PubChem CID 151050988) has the molecular formula C16H30BN3O5 and a molecular weight of 355.24 g/mol. Its IUPAC name is (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-methylbutanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-methylbutanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 151050988 |
| Molecular Formula | C16H30BN3O5 |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | (3aR,4S,5S,6aR)-5-amino-2-[(2S)-2-amino-3-methylbutanoyl]-4-(3-boronopropyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-5-carboxylic acid |
| SMILES | CC(C)[C@H](N)C(=O)N1C[C@@H]2C[C@@](N)(C(=O)O)[C@@H](CCCB(O)O)[C@@H]2C1 |
| InChI | InChI=1S/C16H30BN3O5/c1-9(2)13(18)14(21)20-7-10-6-16(19,15(22)23)12(11(10)8-20)4-3-5-17(24)25/h9-13,24-25H,3-8,18-19H2,1-2H3,(H,22,23)/t10-,11+,12-,13-,16-/m0/s1 |
| InChIKey | MECTVUDXWFGQGG-AWYNBESOSA-N |
| XLogP | -0.90 |
| TPSA | 150.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|