About 2-(2-chloroethoxy)-N,N-diethylethanamine
2-(2-chloroethoxy)-N,N-diethylethanamine (PubChem CID 15105203) has the molecular formula C8H18ClNO
and a molecular weight of 179.69 g/mol. Its IUPAC name is 2-(2-chloroethoxy)-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-(2-chloroethoxy)-N,N-diethylethanamine |
| PubChem CID | 15105203 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 2-(2-chloroethoxy)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCOCCCl |
| InChI | InChI=1S/C8H18ClNO/c1-3-10(4-2)6-8-11-7-5-9/h3-8H2,1-2H3 |
| InChIKey | YIYADLTXOIIHTN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethoxy)-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethoxy)-N,N-diethylethanamine?
The IUPAC name of 2-(2-chloroethoxy)-N,N-diethylethanamine (CID 15105203) is 2-(2-chloroethoxy)-N,N-diethylethanamine.
What is the SMILES notation for 2-(2-chloroethoxy)-N,N-diethylethanamine?
The canonical SMILES for 2-(2-chloroethoxy)-N,N-diethylethanamine is CCN(CC)CCOCCCl.
What is the InChIKey of 2-(2-chloroethoxy)-N,N-diethylethanamine?
The InChIKey is YIYADLTXOIIHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18ClNO/c1-3-10(4-2)6-8-11-7-5-9/h3-8H2,1-2H3.
What are the key properties of 2-(2-chloroethoxy)-N,N-diethylethanamine?
2-(2-chloroethoxy)-N,N-diethylethanamine has a molecular weight of 179.69 g/mol, XLogP of 1.58, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethoxy)-N,N-diethylethanamine is sourced from PubChem (CID 15105203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).