C22H22N6O5 — CID 15105316
ethyl N-[6-amino-4-[[(2E)-2-hydroxyimino-1,2-diphenylethyl]amino]-5-nitro-2-pyridinyl]carbamate (PubChem CID 15105316) has the molecular formula C22H22N6O5 and a molecular weight of 450.46 g/mol. Its IUPAC name is ethyl N-[6-amino-4-[[(2E)-2-hydroxyimino-1,2-diphenylethyl]amino]-5-nitro-2-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-amino-4-[[(2E)-2-hydroxyimino-1,2-diphenylethyl]amino]-5-nitro-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 15105316 |
| Molecular Formula | C22H22N6O5 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethyl N-[6-amino-4-[[(2E)-2-hydroxyimino-1,2-diphenylethyl]amino]-5-nitro-2-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(NC(/C(=N/O)c2ccccc2)c2ccccc2)c([N+](=O)[O-])c(N)n1 |
| InChI | InChI=1S/C22H22N6O5/c1-2-33-22(29)26-17-13-16(20(28(31)32)21(23)25-17)24-18(14-9-5-3-6-10-14)19(27-30)15-11-7-4-8-12-15/h3-13,18,30H,2H2,1H3,(H4,23,24,25,26,29)/b27-19+ |
| InChIKey | ZRHMKEWLAZQYFP-ZXVVBBHZSA-N |
| XLogP | 4.17 |
| TPSA | 165.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|