C15H18F2N2O — CID 151053603
7,8-difluoro-4-[1-(2-methylpropylamino)ethyl]-2H-isoquinolin-1-one (PubChem CID 151053603) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is 7,8-difluoro-4-[1-(2-methylpropylamino)ethyl]-2H-isoquinolin-1-one.
| Compound Name | 7,8-difluoro-4-[1-(2-methylpropylamino)ethyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 151053603 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 7,8-difluoro-4-[1-(2-methylpropylamino)ethyl]-2H-isoquinolin-1-one |
| SMILES | CC(C)CNC(C)c1c[nH]c(=O)c2c(F)c(F)ccc12 |
| InChI | InChI=1S/C15H18F2N2O/c1-8(2)6-18-9(3)11-7-19-15(20)13-10(11)4-5-12(16)14(13)17/h4-5,7-9,18H,6H2,1-3H3,(H,19,20) |
| InChIKey | MEQKFJDKBRGQNK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |