About 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid
1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid (PubChem CID 151054672) has the molecular formula C17H28F2NO2+
and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid |
| PubChem CID | 151054672 |
| Molecular Formula | C17H28F2NO2+ |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid |
| SMILES | C[N+]1(CCCCCCCCCC(F)F)C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C17H27F2NO2/c1-20(13-10-15(11-14-20)17(21)22)12-8-6-4-2-3-5-7-9-16(18)19/h10-11,13,16H,2-9,12,14H2,1H3/p+1 |
| InChIKey | MEVYKOPIUKXYFH-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid?
The IUPAC name of 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid (CID 151054672) is 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid.
What is the SMILES notation for 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid?
The canonical SMILES for 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid is C[N+]1(CCCCCCCCCC(F)F)C=CC(C(=O)O)=CC1.
What is the InChIKey of 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid?
The InChIKey is MEVYKOPIUKXYFH-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H27F2NO2/c1-20(13-10-15(11-14-20)17(21)22)12-8-6-4-2-3-5-7-9-16(18)19/h10-11,13,16H,2-9,12,14H2,1H3/p+1.
What are the key properties of 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid?
1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid has a molecular weight of 316.41 g/mol, XLogP of 4.36, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(10,10-difluorodecyl)-1-methyl-2H-pyridin-1-ium-4-carboxylic acid is sourced from PubChem (CID 151054672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).