C27H45NO2 — CID 151055579
2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-N-propan-2-ylbutanamide (PubChem CID 151055579) has the molecular formula C27H45NO2 and a molecular weight of 415.66 g/mol. Its IUPAC name is 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-N-propan-2-ylbutanamide.
| Compound Name | 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 151055579 |
| Molecular Formula | C27H45NO2 |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.35 |
| IUPAC Name | 2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-N-propan-2-ylbutanamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)NC(C)C |
| InChI | InChI=1S/C27H45NO2/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-30-26(6-2)27(29)28-25(3)4/h7-8,10-11,13-14,16-17,19-20,25-26H,5-6,9,12,15,18,21-24H2,1-4H3,(H,28,29)/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | MFAUIWCRLQXUFL-NEUKSRIFSA-N |
| XLogP | 7.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|