C6H11F5IN — CID 15105657
trimethyl(2,2,3,3,3-pentafluoropropyl)azanium iodide (PubChem CID 15105657) has the molecular formula C6H11F5IN and a molecular weight of 319.06 g/mol. Its IUPAC name is trimethyl(2,2,3,3,3-pentafluoropropyl)azanium iodide.
| Compound Name | trimethyl(2,2,3,3,3-pentafluoropropyl)azanium iodide |
|---|---|
| PubChem CID | 15105657 |
| Molecular Formula | C6H11F5IN |
| Molecular Weight | 319.06 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | trimethyl(2,2,3,3,3-pentafluoropropyl)azanium iodide |
| SMILES | C[N+](C)(C)CC(F)(F)C(F)(F)F.[I-] |
| InChI | InChI=1S/C6H11F5N.HI/c1-12(2,3)4-5(7,8)6(9,10)11;/h4H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | BKXBJXRCEONDTL-UHFFFAOYSA-M |
| XLogP | -1.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.06 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|