About N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride
N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride (PubChem CID 15106) has the molecular formula C12H16Cl2N2
and a molecular weight of 259.18 g/mol. Its IUPAC name is N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| PubChem CID | 15106 |
| Molecular Formula | C12H16Cl2N2 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCNc1cccc2ccccc12 |
| InChI | InChI=1S/C12H14N2.2ClH/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;;/h1-7,14H,8-9,13H2;2*1H |
| InChIKey | MZNYWPRCVDMOJG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride?
The IUPAC name of N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride (CID 15106) is N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride?
The canonical SMILES for N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride is Cl.Cl.NCCNc1cccc2ccccc12.
What is the InChIKey of N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride?
The InChIKey is MZNYWPRCVDMOJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2.2ClH/c13-8-9-14-12-7-3-5-10-4-1-2-6-11(10)12;;/h1-7,14H,8-9,13H2;2*1H.
What are the key properties of N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride?
N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride has a molecular weight of 259.18 g/mol, XLogP of 3.05, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-naphthalen-1-ylethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 15106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).