C10H13F5O2 — CID 151062717
2-[(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)methyl]oxetane (PubChem CID 151062717) has the molecular formula C10H13F5O2 and a molecular weight of 260.20 g/mol. Its IUPAC name is 2-[(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)methyl]oxetane.
| Compound Name | 2-[(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)methyl]oxetane |
|---|---|
| PubChem CID | 151062717 |
| Molecular Formula | C10H13F5O2 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-[(2-ethyl-3,3,4,4,4-pentafluorobut-1-enoxy)methyl]oxetane |
| SMILES | CCC(=COCC1CCO1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F5O2/c1-2-7(9(11,12)10(13,14)15)5-16-6-8-3-4-17-8/h5,8H,2-4,6H2,1H3 |
| InChIKey | MGMWQOLIGDRJNH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|