C18H14N2 — CID 151064001
4,18-diazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),8,11,13,15(19),16-octaene (PubChem CID 151064001) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4,18-diazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),8,11,13,15(19),16-octaene.
| Compound Name | 4,18-diazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),8,11,13,15(19),16-octaene |
|---|---|
| PubChem CID | 151064001 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4,18-diazapentacyclo[11.7.0.02,10.03,7.015,19]icosa-1(20),2(10),3(7),8,11,13,15(19),16-octaene |
| SMILES | c1cc2cc3ccc4ccc5c(c4c3cc2[nH]1)NCC5 |
| InChI | InChI=1S/C18H14N2/c1-3-12-5-8-20-18(12)17-11(1)2-4-13-9-14-6-7-19-16(14)10-15(13)17/h1-4,6-7,9-10,19-20H,5,8H2 |
| InChIKey | MGTIMJMEDOGPJY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|