C7H6F9O10S3- — CID 151065155
1,1,1,5,5,5-hexafluoro-2,4-disulfo-3-(2,2,2-trifluoro-1-sulfoethyl)pentan-3-olate (PubChem CID 151065155) has the molecular formula C7H6F9O10S3- and a molecular weight of 517.30 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-2,4-disulfo-3-(2,2,2-trifluoro-1-sulfoethyl)pentan-3-olate.
| Compound Name | 1,1,1,5,5,5-hexafluoro-2,4-disulfo-3-(2,2,2-trifluoro-1-sulfoethyl)pentan-3-olate |
|---|---|
| PubChem CID | 151065155 |
| Molecular Formula | C7H6F9O10S3- |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 516.90 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-2,4-disulfo-3-(2,2,2-trifluoro-1-sulfoethyl)pentan-3-olate |
| SMILES | O=S(=O)(O)C(C(F)(F)F)C([O-])(C(C(F)(F)F)S(=O)(=O)O)C(C(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C7H6F9O10S3/c8-5(9,10)1(27(18,19)20)4(17,2(6(11,12)13)28(21,22)23)3(7(14,15)16)29(24,25)26/h1-3H,(H,18,19,20)(H,21,22,23)(H,24,25,26)/q-1 |
| InChIKey | MGZCOZFKSKVXPF-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 186.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|