About 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane
3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane (PubChem CID 151066748) has the molecular formula C18H34O5
and a molecular weight of 330.47 g/mol. Its IUPAC name is 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane.
Molecular Properties
| Compound Name | 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane |
| PubChem CID | 151066748 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane |
| SMILES | CCC=COCCCC1(OCC)CCCOC1(OCC)OCC |
| InChI | InChI=1S/C18H34O5/c1-5-9-14-19-15-10-12-17(20-6-2)13-11-16-23-18(17,21-7-3)22-8-4/h9,14H,5-8,10-13,15-16H2,1-4H3 |
| InChIKey | MHHBWERIUKBFTM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane?
The IUPAC name of 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane (CID 151066748) is 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane.
What is the SMILES notation for 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane?
The canonical SMILES for 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane is CCC=COCCCC1(OCC)CCCOC1(OCC)OCC.
What is the InChIKey of 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane?
The InChIKey is MHHBWERIUKBFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O5/c1-5-9-14-19-15-10-12-17(20-6-2)13-11-16-23-18(17,21-7-3)22-8-4/h9,14H,5-8,10-13,15-16H2,1-4H3.
What are the key properties of 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane?
3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane has a molecular weight of 330.47 g/mol, XLogP of 4.02, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-but-1-enoxypropyl)-2,2,3-triethoxyoxane is sourced from PubChem (CID 151066748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).