About 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane
10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane (PubChem CID 15106922) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| PubChem CID | 15106922 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane |
| SMILES | CN1C2CCC1C1CNCC12 |
| InChI | InChI=1S/C9H16N2/c1-11-8-2-3-9(11)7-5-10-4-6(7)8/h6-10H,2-5H2,1H3 |
| InChIKey | BRULRIFZNCHLMK-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The IUPAC name of 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane (CID 15106922) is 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The canonical SMILES for 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane is CN1C2CCC1C1CNCC12.
What is the InChIKey of 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane?
The InChIKey is BRULRIFZNCHLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-11-8-2-3-9(11)7-5-10-4-6(7)8/h6-10H,2-5H2,1H3.
What are the key properties of 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane?
10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane has a molecular weight of 152.24 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-4,10-diazatricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 15106922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).