C21H29NO4 — CID 15107108
benzyl (4S,5R)-4-(cyclohexylmethyl)-5-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 15107108) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is benzyl (4S,5R)-4-(cyclohexylmethyl)-5-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (4S,5R)-4-(cyclohexylmethyl)-5-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15107108 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | benzyl (4S,5R)-4-(cyclohexylmethyl)-5-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)O[C@@H](C=O)[C@H](CC2CCCCC2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-21(2)22(20(24)25-15-17-11-7-4-8-12-17)18(19(14-23)26-21)13-16-9-5-3-6-10-16/h4,7-8,11-12,14,16,18-19H,3,5-6,9-10,13,15H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | CEOYJALXSWILPA-OALUTQOASA-N |
| XLogP | 4.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|