About 6-butyl-5H-thiopyrano[2,3-c]pyrrole
6-butyl-5H-thiopyrano[2,3-c]pyrrole (PubChem CID 151071208) has the molecular formula C11H15NS
and a molecular weight of 193.31 g/mol. Its IUPAC name is 6-butyl-5H-thiopyrano[2,3-c]pyrrole.
Molecular Properties
| Compound Name | 6-butyl-5H-thiopyrano[2,3-c]pyrrole |
| PubChem CID | 151071208 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-butyl-5H-thiopyrano[2,3-c]pyrrole |
| SMILES | CCCCN1C=C2SC=CC=C2C1 |
| InChI | InChI=1S/C11H15NS/c1-2-3-6-12-8-10-5-4-7-13-11(10)9-12/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | MIEAZONEFGHRGS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butyl-5H-thiopyrano[2,3-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-5H-thiopyrano[2,3-c]pyrrole?
The IUPAC name of 6-butyl-5H-thiopyrano[2,3-c]pyrrole (CID 151071208) is 6-butyl-5H-thiopyrano[2,3-c]pyrrole.
What is the SMILES notation for 6-butyl-5H-thiopyrano[2,3-c]pyrrole?
The canonical SMILES for 6-butyl-5H-thiopyrano[2,3-c]pyrrole is CCCCN1C=C2SC=CC=C2C1.
What is the InChIKey of 6-butyl-5H-thiopyrano[2,3-c]pyrrole?
The InChIKey is MIEAZONEFGHRGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NS/c1-2-3-6-12-8-10-5-4-7-13-11(10)9-12/h4-5,7,9H,2-3,6,8H2,1H3.
What are the key properties of 6-butyl-5H-thiopyrano[2,3-c]pyrrole?
6-butyl-5H-thiopyrano[2,3-c]pyrrole has a molecular weight of 193.31 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-5H-thiopyrano[2,3-c]pyrrole is sourced from PubChem (CID 151071208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).