C16H11Cl3F3NO2 — CID 151071713
N-[6-benzoyl-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-2,2,2-trichloroacetamide (PubChem CID 151071713) has the molecular formula C16H11Cl3F3NO2 and a molecular weight of 412.62 g/mol. Its IUPAC name is N-[6-benzoyl-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[6-benzoyl-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 151071713 |
| Molecular Formula | C16H11Cl3F3NO2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | N-[6-benzoyl-6-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]-2,2,2-trichloroacetamide |
| SMILES | O=C(NC1C=CC=CC1(C(=O)c1ccccc1)C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H11Cl3F3NO2/c17-15(18,19)13(25)23-11-8-4-5-9-14(11,16(20,21)22)12(24)10-6-2-1-3-7-10/h1-9,11H,(H,23,25) |
| InChIKey | MIGSJMQOSWLGIB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|