About 2-bromo-3-cyclopropyl-1,2-dihydropyrazine
2-bromo-3-cyclopropyl-1,2-dihydropyrazine (PubChem CID 151072811) has the molecular formula C7H9BrN2
and a molecular weight of 201.07 g/mol. Its IUPAC name is 2-bromo-3-cyclopropyl-1,2-dihydropyrazine.
Molecular Properties
| Compound Name | 2-bromo-3-cyclopropyl-1,2-dihydropyrazine |
| PubChem CID | 151072811 |
| Molecular Formula | C7H9BrN2 |
| Molecular Weight | 201.07 g/mol |
| Exact Mass | 199.99 |
| IUPAC Name | 2-bromo-3-cyclopropyl-1,2-dihydropyrazine |
| SMILES | BrC1NC=CN=C1C1CC1 |
| InChI | InChI=1S/C7H9BrN2/c8-7-6(5-1-2-5)9-3-4-10-7/h3-5,7,10H,1-2H2 |
| InChIKey | MIMHUSCRKOZBJM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.07 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-cyclopropyl-1,2-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-cyclopropyl-1,2-dihydropyrazine?
The IUPAC name of 2-bromo-3-cyclopropyl-1,2-dihydropyrazine (CID 151072811) is 2-bromo-3-cyclopropyl-1,2-dihydropyrazine.
What is the SMILES notation for 2-bromo-3-cyclopropyl-1,2-dihydropyrazine?
The canonical SMILES for 2-bromo-3-cyclopropyl-1,2-dihydropyrazine is BrC1NC=CN=C1C1CC1.
What is the InChIKey of 2-bromo-3-cyclopropyl-1,2-dihydropyrazine?
The InChIKey is MIMHUSCRKOZBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2/c8-7-6(5-1-2-5)9-3-4-10-7/h3-5,7,10H,1-2H2.
What are the key properties of 2-bromo-3-cyclopropyl-1,2-dihydropyrazine?
2-bromo-3-cyclopropyl-1,2-dihydropyrazine has a molecular weight of 201.07 g/mol, XLogP of 1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-cyclopropyl-1,2-dihydropyrazine is sourced from PubChem (CID 151072811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).