About (3-methyl-5-nitrophenyl) methanesulfonate
(3-methyl-5-nitrophenyl) methanesulfonate (PubChem CID 151073917) has the molecular formula C8H9NO5S
and a molecular weight of 231.23 g/mol. Its IUPAC name is (3-methyl-5-nitrophenyl) methanesulfonate.
Molecular Properties
| Compound Name | (3-methyl-5-nitrophenyl) methanesulfonate |
| PubChem CID | 151073917 |
| Molecular Formula | C8H9NO5S |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | (3-methyl-5-nitrophenyl) methanesulfonate |
| SMILES | Cc1cc(OS(C)(=O)=O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H9NO5S/c1-6-3-7(9(10)11)5-8(4-6)14-15(2,12)13/h3-5H,1-2H3 |
| InChIKey | MIRYAHCUEHJIJL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-5-nitrophenyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-5-nitrophenyl) methanesulfonate?
The IUPAC name of (3-methyl-5-nitrophenyl) methanesulfonate (CID 151073917) is (3-methyl-5-nitrophenyl) methanesulfonate.
What is the SMILES notation for (3-methyl-5-nitrophenyl) methanesulfonate?
The canonical SMILES for (3-methyl-5-nitrophenyl) methanesulfonate is Cc1cc(OS(C)(=O)=O)cc([N+](=O)[O-])c1.
What is the InChIKey of (3-methyl-5-nitrophenyl) methanesulfonate?
The InChIKey is MIRYAHCUEHJIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO5S/c1-6-3-7(9(10)11)5-8(4-6)14-15(2,12)13/h3-5H,1-2H3.
What are the key properties of (3-methyl-5-nitrophenyl) methanesulfonate?
(3-methyl-5-nitrophenyl) methanesulfonate has a molecular weight of 231.23 g/mol, XLogP of 1.24, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-5-nitrophenyl) methanesulfonate is sourced from PubChem (CID 151073917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).