About [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate
[diacetyloxy(methyl)silyl] 2-(diethylamino)acetate (PubChem CID 151074331) has the molecular formula C11H21NO6Si
and a molecular weight of 291.38 g/mol. Its IUPAC name is [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate.
Molecular Properties
| Compound Name | [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate |
| PubChem CID | 151074331 |
| Molecular Formula | C11H21NO6Si |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate |
| SMILES | CCN(CC)CC(=O)O[Si](C)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C11H21NO6Si/c1-6-12(7-2)8-11(15)18-19(5,16-9(3)13)17-10(4)14/h6-8H2,1-5H3 |
| InChIKey | MIUBRFYPKYNYDO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate?
The IUPAC name of [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate (CID 151074331) is [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate.
What is the SMILES notation for [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate?
The canonical SMILES for [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate is CCN(CC)CC(=O)O[Si](C)(OC(C)=O)OC(C)=O.
What is the InChIKey of [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate?
The InChIKey is MIUBRFYPKYNYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO6Si/c1-6-12(7-2)8-11(15)18-19(5,16-9(3)13)17-10(4)14/h6-8H2,1-5H3.
What are the key properties of [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate?
[diacetyloxy(methyl)silyl] 2-(diethylamino)acetate has a molecular weight of 291.38 g/mol, XLogP of 0.57, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(methyl)silyl] 2-(diethylamino)acetate is sourced from PubChem (CID 151074331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).