About 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane
6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane (PubChem CID 15107465) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane |
| PubChem CID | 15107465 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane |
| SMILES | CC(C)CN1CCC2(CNC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-9(2)5-12-4-3-10(8-12)6-11-7-10/h9,11H,3-8H2,1-2H3 |
| InChIKey | WBGNBCDKAQWCRV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane?
The IUPAC name of 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane (CID 15107465) is 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane.
What is the SMILES notation for 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane?
The canonical SMILES for 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane is CC(C)CN1CCC2(CNC2)C1.
What is the InChIKey of 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane?
The InChIKey is WBGNBCDKAQWCRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2/c1-9(2)5-12-4-3-10(8-12)6-11-7-10/h9,11H,3-8H2,1-2H3.
What are the key properties of 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane?
6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane has a molecular weight of 168.28 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylpropyl)-2,6-diazaspiro[3.4]octane is sourced from PubChem (CID 15107465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).