C22H39NO7S2 — CID 15107583
tert-butyl (4S,5S)-4-(cyclohexylmethyl)-2,2-dimethyl-5-[(1,1,3,3-tetraoxo-1,3-dithian-2-yl)methyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 15107583) has the molecular formula C22H39NO7S2 and a molecular weight of 493.69 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-(cyclohexylmethyl)-2,2-dimethyl-5-[(1,1,3,3-tetraoxo-1,3-dithian-2-yl)methyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-(cyclohexylmethyl)-2,2-dimethyl-5-[(1,1,3,3-tetraoxo-1,3-dithian-2-yl)methyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 15107583 |
| Molecular Formula | C22H39NO7S2 |
| Molecular Weight | 493.69 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | tert-butyl (4S,5S)-4-(cyclohexylmethyl)-2,2-dimethyl-5-[(1,1,3,3-tetraoxo-1,3-dithian-2-yl)methyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2CCCCC2)[C@H](CC2S(=O)(=O)CCCS2(=O)=O)OC1(C)C |
| InChI | InChI=1S/C22H39NO7S2/c1-21(2,3)30-20(24)23-17(14-16-10-7-6-8-11-16)18(29-22(23,4)5)15-19-31(25,26)12-9-13-32(19,27)28/h16-19H,6-15H2,1-5H3/t17-,18-/m0/s1 |
| InChIKey | OKKNCKKPJDHBFO-ROUUACIJSA-N |
| XLogP | 3.65 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |