C13H15F3N2O2 — CID 151077073
4-(2,2,2-trifluoro-1-phenylethyl)piperazine-1-carboxylic acid (PubChem CID 151077073) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 4-(2,2,2-trifluoro-1-phenylethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(2,2,2-trifluoro-1-phenylethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 151077073 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 4-(2,2,2-trifluoro-1-phenylethyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(c2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)11(10-4-2-1-3-5-10)17-6-8-18(9-7-17)12(19)20/h1-5,11H,6-9H2,(H,19,20) |
| InChIKey | MJIKUVRJAAFLBE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |