About [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol
[3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol (PubChem CID 151081731) has the molecular formula C21H39F3O2
and a molecular weight of 380.54 g/mol. Its IUPAC name is [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol |
| PubChem CID | 151081731 |
| Molecular Formula | C21H39F3O2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol |
| SMILES | CC(C)(C)CCCCCCCCCOC1(C(F)(F)F)CCCC(CO)C1 |
| InChI | InChI=1S/C21H39F3O2/c1-19(2,3)13-9-7-5-4-6-8-10-15-26-20(21(22,23)24)14-11-12-18(16-20)17-25/h18,25H,4-17H2,1-3H3 |
| InChIKey | MKGRCPFDIIJTSB-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol?
The IUPAC name of [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol (CID 151081731) is [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol.
What is the SMILES notation for [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol?
The canonical SMILES for [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol is CC(C)(C)CCCCCCCCCOC1(C(F)(F)F)CCCC(CO)C1.
What is the InChIKey of [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol?
The InChIKey is MKGRCPFDIIJTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39F3O2/c1-19(2,3)13-9-7-5-4-6-8-10-15-26-20(21(22,23)24)14-11-12-18(16-20)17-25/h18,25H,4-17H2,1-3H3.
What are the key properties of [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol?
[3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol has a molecular weight of 380.54 g/mol, XLogP of 6.65, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(10,10-dimethylundecoxy)-3-(trifluoromethyl)cyclohexyl]methanol is sourced from PubChem (CID 151081731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).