C21H29BrO2 — CID 15108264
methyl (2E,4E,6E,8E)-9-(3-bromo-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 15108264) has the molecular formula C21H29BrO2 and a molecular weight of 393.37 g/mol. Its IUPAC name is methyl (2E,4E,6E,8E)-9-(3-bromo-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E,8E)-9-(3-bromo-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 15108264 |
| Molecular Formula | C21H29BrO2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | methyl (2E,4E,6E,8E)-9-(3-bromo-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | COC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(Br)CCC1(C)C |
| InChI | InChI=1S/C21H29BrO2/c1-15(8-7-9-16(2)14-20(23)24-6)10-11-18-17(3)19(22)12-13-21(18,4)5/h7-11,14,19H,12-13H2,1-6H3/b9-7+,11-10+,15-8+,16-14+ |
| InChIKey | GFHYFTKVQYDVHT-XPSLGPGOSA-N |
| XLogP | 6.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|