C24H36O4 — CID 15108272
[(2E,4E,6E)-8-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate (PubChem CID 15108272) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(2E,4E,6E)-8-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate.
| Compound Name | [(2E,4E,6E)-8-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate |
|---|---|
| PubChem CID | 15108272 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(2E,4E,6E)-8-acetyloxy-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trienyl] acetate |
| SMILES | CC(=O)OC/C=C(C)/C=C/C=C(\C)C(CC1=C(C)CCCC1(C)C)OC(C)=O |
| InChI | InChI=1S/C24H36O4/c1-17(13-15-27-20(4)25)10-8-11-19(3)23(28-21(5)26)16-22-18(2)12-9-14-24(22,6)7/h8,10-11,13,23H,9,12,14-16H2,1-7H3/b10-8+,17-13+,19-11+ |
| InChIKey | GREYOZFKFJAJJZ-HZAVZBIUSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|