C24H22N2O2 — CID 151084605
[6-(benzhydrylideneamino)-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate (PubChem CID 151084605) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is [6-(benzhydrylideneamino)-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate.
| Compound Name | [6-(benzhydrylideneamino)-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate |
|---|---|
| PubChem CID | 151084605 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [6-(benzhydrylideneamino)-1,2,3,4-tetrahydronaphthalen-2-yl] carbamate |
| SMILES | NC(=O)OC1CCc2cc(N=C(c3ccccc3)c3ccccc3)ccc2C1 |
| InChI | InChI=1S/C24H22N2O2/c25-24(27)28-22-14-12-19-15-21(13-11-20(19)16-22)26-23(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-11,13,15,22H,12,14,16H2,(H2,25,27) |
| InChIKey | MKVOXRCYYHTJDZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|