C17H22FNO3S — CID 151085565
4-[4-[4-(fluoromethylsulfanyl)phenyl]-4-oxobutyl]piperidine-1-carboxylic acid (PubChem CID 151085565) has the molecular formula C17H22FNO3S and a molecular weight of 339.43 g/mol. Its IUPAC name is 4-[4-[4-(fluoromethylsulfanyl)phenyl]-4-oxobutyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[4-(fluoromethylsulfanyl)phenyl]-4-oxobutyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151085565 |
| Molecular Formula | C17H22FNO3S |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-[4-[4-(fluoromethylsulfanyl)phenyl]-4-oxobutyl]piperidine-1-carboxylic acid |
| SMILES | O=C(CCCC1CCN(C(=O)O)CC1)c1ccc(SCF)cc1 |
| InChI | InChI=1S/C17H22FNO3S/c18-12-23-15-6-4-14(5-7-15)16(20)3-1-2-13-8-10-19(11-9-13)17(21)22/h4-7,13H,1-3,8-12H2,(H,21,22) |
| InChIKey | MLAKEDFPVNPKRA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |