About [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate
[2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate (PubChem CID 15108676) has the molecular formula C29H24O5
and a molecular weight of 452.51 g/mol. Its IUPAC name is [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate.
Molecular Properties
| Compound Name | [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate |
| PubChem CID | 15108676 |
| Molecular Formula | C29H24O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate |
| SMILES | CC(=O)c1c(OCc2ccccc2)cc(OCc2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H24O5/c1-21(30)28-26(33-20-23-13-7-3-8-14-23)17-25(32-19-22-11-5-2-6-12-22)18-27(28)34-29(31)24-15-9-4-10-16-24/h2-18H,19-20H2,1H3 |
| InChIKey | KFJGEGBDEGHMTR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate?
The IUPAC name of [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate (CID 15108676) is [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate.
What is the SMILES notation for [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate?
The canonical SMILES for [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate is CC(=O)c1c(OCc2ccccc2)cc(OCc2ccccc2)cc1OC(=O)c1ccccc1.
What is the InChIKey of [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate?
The InChIKey is KFJGEGBDEGHMTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24O5/c1-21(30)28-26(33-20-23-13-7-3-8-14-23)17-25(32-19-22-11-5-2-6-12-22)18-27(28)34-29(31)24-15-9-4-10-16-24/h2-18H,19-20H2,1H3.
What are the key properties of [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate?
[2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate has a molecular weight of 452.51 g/mol, XLogP of 6.27, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetyl-3,5-bis(phenylmethoxy)phenyl] benzoate is sourced from PubChem (CID 15108676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).