C10H15NO — CID 151086895
N-(3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-ylidene)hydroxylamine (PubChem CID 151086895) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-(3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-ylidene)hydroxylamine.
| Compound Name | N-(3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 151086895 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-(3,4,4a,5,8,8a-hexahydro-2H-naphthalen-1-ylidene)hydroxylamine |
| SMILES | ON=C1CCCC2CC=CCC12 |
| InChI | InChI=1S/C10H15NO/c12-11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,8-9,12H,3-7H2 |
| InChIKey | MLHIPSDXICOSRE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|