C22H46N4 — CID 151089009
N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 151089009) has the molecular formula C22H46N4 and a molecular weight of 366.64 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 151089009 |
| Molecular Formula | C22H46N4 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.37 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CN(CCN(C)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C22H46N4/c1-19(2)13-17(14-20(3,4)23-19)25(9)11-12-26(10)18-15-21(5,6)24-22(7,8)16-18/h17-18,23-24H,11-16H2,1-10H3 |
| InChIKey | MLSOVEUEKKGCPF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |