C10H16Cl3NO7 — CID 15108991
2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate (PubChem CID 15108991) has the molecular formula C10H16Cl3NO7 and a molecular weight of 368.60 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 15108991 |
| Molecular Formula | C10H16Cl3NO7 |
| Molecular Weight | 368.60 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]carbamate |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H16Cl3NO7/c1-19-8-5(7(17)6(16)4(2-15)21-8)14-9(18)20-3-10(11,12)13/h4-8,15-17H,2-3H2,1H3,(H,14,18)/t4-,5-,6-,7-,8+/m1/s1 |
| InChIKey | AIIAXIHFBLEKKO-PVFLNQBWSA-N |
| XLogP | -0.46 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.60 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|