About 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane
1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane (PubChem CID 151091134) has the molecular formula C17H35ClO2S
and a molecular weight of 338.99 g/mol. Its IUPAC name is 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane.
Molecular Properties
| Compound Name | 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane |
| PubChem CID | 151091134 |
| Molecular Formula | C17H35ClO2S |
| Molecular Weight | 338.99 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane |
| SMILES | CCCCCCCCCC(C)(C)CCCS(=O)(=O)CCCl |
| InChI | InChI=1S/C17H35ClO2S/c1-4-5-6-7-8-9-10-12-17(2,3)13-11-15-21(19,20)16-14-18/h4-16H2,1-3H3 |
| InChIKey | MMDPUHNBBMAYRZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.99 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane?
The IUPAC name of 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane (CID 151091134) is 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane.
What is the SMILES notation for 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane?
The canonical SMILES for 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane is CCCCCCCCCC(C)(C)CCCS(=O)(=O)CCCl.
What is the InChIKey of 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane?
The InChIKey is MMDPUHNBBMAYRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35ClO2S/c1-4-5-6-7-8-9-10-12-17(2,3)13-11-15-21(19,20)16-14-18/h4-16H2,1-3H3.
What are the key properties of 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane?
1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane has a molecular weight of 338.99 g/mol, XLogP of 5.59, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethylsulfonyl)-4,4-dimethyltridecane is sourced from PubChem (CID 151091134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).