About (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one
(4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one (PubChem CID 15109267) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one.
Analyze (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one?
The IUPAC name of (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one (CID 15109267) is (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one.
What is the SMILES notation for (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one?
The canonical SMILES for (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one is O=C1O[C@@H]2CCN3CC[C@H]1[C@H]23.
What is the InChIKey of (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one?
The InChIKey is RYWDCLFOABOLBP-RRKCRQDMSA-N. The full InChI is InChI=1S/C8H11NO2/c10-8-5-1-3-9-4-2-6(11-8)7(5)9/h5-7H,1-4H2/t5-,6+,7+/m0/s1.
What are the key properties of (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one?
(4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one has a molecular weight of 153.18 g/mol, XLogP of 0.01, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,7S,10R)-5-oxa-1-azatricyclo[5.2.1.04,10]decan-6-one is sourced from PubChem (CID 15109267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).