About 2-sulfanylethenyl acetate
2-sulfanylethenyl acetate (PubChem CID 151093628) has the molecular formula C4H6O2S
and a molecular weight of 118.16 g/mol. Its IUPAC name is 2-sulfanylethenyl acetate.
Molecular Properties
| Compound Name | 2-sulfanylethenyl acetate |
| PubChem CID | 151093628 |
| Molecular Formula | C4H6O2S |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.01 |
| IUPAC Name | 2-sulfanylethenyl acetate |
| SMILES | CC(=O)OC=CS |
| InChI | InChI=1S/C4H6O2S/c1-4(5)6-2-3-7/h2-3,7H,1H3 |
| InChIKey | MMQPQYAGAHLRIO-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylethenyl acetate?
The IUPAC name of 2-sulfanylethenyl acetate (CID 151093628) is 2-sulfanylethenyl acetate.
What is the SMILES notation for 2-sulfanylethenyl acetate?
The canonical SMILES for 2-sulfanylethenyl acetate is CC(=O)OC=CS.
What is the InChIKey of 2-sulfanylethenyl acetate?
The InChIKey is MMQPQYAGAHLRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2S/c1-4(5)6-2-3-7/h2-3,7H,1H3.
What are the key properties of 2-sulfanylethenyl acetate?
2-sulfanylethenyl acetate has a molecular weight of 118.16 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylethenyl acetate is sourced from PubChem (CID 151093628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).