C8H12N2O2 — CID 151093895
2-(ethoxymethyl)-5-methyl-1H-pyrimidin-6-one (PubChem CID 151093895) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-(ethoxymethyl)-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(ethoxymethyl)-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 151093895 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-(ethoxymethyl)-5-methyl-1H-pyrimidin-6-one |
| SMILES | CCOCc1ncc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-12-5-7-9-4-6(2)8(11)10-7/h4H,3,5H2,1-2H3,(H,9,10,11) |
| InChIKey | MMRVWKQLNDHBGY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |