C24H24BFN4O10 — CID 151094026
(3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(2-fluoro-4,5-dihydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 151094026) has the molecular formula C24H24BFN4O10 and a molecular weight of 558.28 g/mol. Its IUPAC name is (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(2-fluoro-4,5-dihydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(2-fluoro-4,5-dihydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 151094026 |
| Molecular Formula | C24H24BFN4O10 |
| Molecular Weight | 558.28 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | (3R)-3-[[2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(2-fluoro-4,5-dihydroxyphenyl)acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CCN1CCN(C(=O)NC(C(=O)N[C@H]2Cc3cccc(C(=O)O)c3OB2O)c2cc(O)c(O)cc2F)C(=O)C1=O |
| InChI | InChI=1S/C24H24BFN4O10/c1-2-29-6-7-30(22(35)21(29)34)24(38)28-18(13-9-15(31)16(32)10-14(13)26)20(33)27-17-8-11-4-3-5-12(23(36)37)19(11)40-25(17)39/h3-5,9-10,17-18,31-32,39H,2,6-8H2,1H3,(H,27,33)(H,28,38)(H,36,37)/t17-,18?/m0/s1 |
| InChIKey | MMSNBTWJWWMORO-ZENAZSQFSA-N |
| XLogP | -0.48 |
| TPSA | 206.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|