C12H20O4 — CID 15109416
(3R,4R)-4-(hydroxymethyl)-3-(5-methylhexanoyl)oxolan-2-one (PubChem CID 15109416) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3R,4R)-4-(hydroxymethyl)-3-(5-methylhexanoyl)oxolan-2-one.
| Compound Name | (3R,4R)-4-(hydroxymethyl)-3-(5-methylhexanoyl)oxolan-2-one |
|---|---|
| PubChem CID | 15109416 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3R,4R)-4-(hydroxymethyl)-3-(5-methylhexanoyl)oxolan-2-one |
| SMILES | CC(C)CCCC(=O)[C@@H]1C(=O)OC[C@H]1CO |
| InChI | InChI=1S/C12H20O4/c1-8(2)4-3-5-10(14)11-9(6-13)7-16-12(11)15/h8-9,11,13H,3-7H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | YSSMVENMLICSMX-MWLCHTKSSA-N |
| XLogP | 1.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|