C48H50O — CID 151096565
2-[2-[2,3-bis(2,4,6-trimethylphenyl)phenoxy]-6-(2,4,6-trimethylphenyl)phenyl]-1,3,5-trimethylbenzene (PubChem CID 151096565) has the molecular formula C48H50O and a molecular weight of 642.93 g/mol. Its IUPAC name is 2-[2-[2,3-bis(2,4,6-trimethylphenyl)phenoxy]-6-(2,4,6-trimethylphenyl)phenyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[2-[2,3-bis(2,4,6-trimethylphenyl)phenoxy]-6-(2,4,6-trimethylphenyl)phenyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 151096565 |
| Molecular Formula | C48H50O |
| Molecular Weight | 642.93 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 2-[2-[2,3-bis(2,4,6-trimethylphenyl)phenoxy]-6-(2,4,6-trimethylphenyl)phenyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(-c2cccc(Oc3cccc(-c4c(C)cc(C)cc4C)c3-c3c(C)cc(C)cc3C)c2-c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C48H50O/c1-27-19-31(5)43(32(6)20-27)39-15-13-17-41(47(39)45-35(9)23-29(3)24-36(45)10)49-42-18-14-16-40(44-33(7)21-28(2)22-34(44)8)48(42)46-37(11)25-30(4)26-38(46)12/h13-26H,1-12H3 |
| InChIKey | MNFVHEBBRUAMGP-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.93 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |