C21H26N4O5 — CID 151097041
methyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[[(3S)-pyrrolidin-3-yl]methylcarbamoyl]-1,4-dihydropyridine-3-carboxylate (PubChem CID 151097041) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is methyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[[(3S)-pyrrolidin-3-yl]methylcarbamoyl]-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[[(3S)-pyrrolidin-3-yl]methylcarbamoyl]-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 151097041 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | methyl 2,6-dimethyl-4-(3-nitrophenyl)-5-[[(3S)-pyrrolidin-3-yl]methylcarbamoyl]-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)NC[C@H]2CCNC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N4O5/c1-12-17(20(26)23-11-14-7-8-22-10-14)19(18(13(2)24-12)21(27)30-3)15-5-4-6-16(9-15)25(28)29/h4-6,9,14,19,22,24H,7-8,10-11H2,1-3H3,(H,23,26)/t14-,19?/m0/s1 |
| InChIKey | MNIFERRVTNGBEK-KTQQKIMGSA-N |
| XLogP | 1.73 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|