C11H15F5O2 — CID 151098513
4-methyl-1-[3-(1,1,2,2,2-pentafluoroethyl)oxetan-2-yl]pent-3-en-2-ol (PubChem CID 151098513) has the molecular formula C11H15F5O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is 4-methyl-1-[3-(1,1,2,2,2-pentafluoroethyl)oxetan-2-yl]pent-3-en-2-ol.
| Compound Name | 4-methyl-1-[3-(1,1,2,2,2-pentafluoroethyl)oxetan-2-yl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 151098513 |
| Molecular Formula | C11H15F5O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-methyl-1-[3-(1,1,2,2,2-pentafluoroethyl)oxetan-2-yl]pent-3-en-2-ol |
| SMILES | CC(C)=CC(O)CC1OCC1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H15F5O2/c1-6(2)3-7(17)4-9-8(5-18-9)10(12,13)11(14,15)16/h3,7-9,17H,4-5H2,1-2H3 |
| InChIKey | MNPZTVIKWBVMMA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|