C19H20O6 — CID 151098682
4-[[2-(2-methoxyethoxy)phenyl]methyl]-5-methylbenzene-1,3-dicarboxylic acid (PubChem CID 151098682) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is 4-[[2-(2-methoxyethoxy)phenyl]methyl]-5-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[2-(2-methoxyethoxy)phenyl]methyl]-5-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 151098682 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[[2-(2-methoxyethoxy)phenyl]methyl]-5-methylbenzene-1,3-dicarboxylic acid |
| SMILES | COCCOc1ccccc1Cc1c(C)cc(C(=O)O)cc1C(=O)O |
| InChI | InChI=1S/C19H20O6/c1-12-9-14(18(20)21)11-16(19(22)23)15(12)10-13-5-3-4-6-17(13)25-8-7-24-2/h3-6,9,11H,7-8,10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | MNQUOMFZTUTXFI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|