About 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane
1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane (PubChem CID 15109929) has the molecular formula C21H45OP
and a molecular weight of 344.56 g/mol. Its IUPAC name is 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane.
Molecular Properties
| Compound Name | 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane |
| PubChem CID | 15109929 |
| Molecular Formula | C21H45OP |
| Molecular Weight | 344.56 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane |
| SMILES | CC(C)CC(C)CP(=O)(CC(C)CC(C)C)CC(C)CC(C)C |
| InChI | InChI=1S/C21H45OP/c1-16(2)10-19(7)13-23(22,14-20(8)11-17(3)4)15-21(9)12-18(5)6/h16-21H,10-15H2,1-9H3 |
| InChIKey | GCJQNOGKVYEPSL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.56 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane?
The IUPAC name of 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane (CID 15109929) is 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane.
What is the SMILES notation for 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane?
The canonical SMILES for 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane is CC(C)CC(C)CP(=O)(CC(C)CC(C)C)CC(C)CC(C)C.
What is the InChIKey of 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane?
The InChIKey is GCJQNOGKVYEPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H45OP/c1-16(2)10-19(7)13-23(22,14-20(8)11-17(3)4)15-21(9)12-18(5)6/h16-21H,10-15H2,1-9H3.
What are the key properties of 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane?
1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane has a molecular weight of 344.56 g/mol, XLogP of 7.40, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(2,4-dimethylpentyl)phosphoryl]-2,4-dimethylpentane is sourced from PubChem (CID 15109929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).