C12H13N — CID 15109946
3,6,8-trimethylquinoline (PubChem CID 15109946) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is 3,6,8-trimethylquinoline.
| Compound Name | 3,6,8-trimethylquinoline |
|---|---|
| PubChem CID | 15109946 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3,6,8-trimethylquinoline |
| SMILES | Cc1cnc2c(C)cc(C)cc2c1 |
| InChI | InChI=1S/C12H13N/c1-8-4-10(3)12-11(5-8)6-9(2)7-13-12/h4-7H,1-3H3 |
| InChIKey | QLKCPMJTBMUIGW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |