C23H25OP — CID 15110065
(5R)-5-ethyl-2,2,2-triphenyl-1,2lambda5-oxaphospholane (PubChem CID 15110065) has the molecular formula C23H25OP and a molecular weight of 348.43 g/mol. Its IUPAC name is (5R)-5-ethyl-2,2,2-triphenyl-1,2lambda5-oxaphospholane.
| Compound Name | (5R)-5-ethyl-2,2,2-triphenyl-1,2lambda5-oxaphospholane |
|---|---|
| PubChem CID | 15110065 |
| Molecular Formula | C23H25OP |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | (5R)-5-ethyl-2,2,2-triphenyl-1,2lambda5-oxaphospholane |
| SMILES | CC[C@@H]1CCP(c2ccccc2)(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C23H25OP/c1-2-20-18-19-25(24-20,21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20H,2,18-19H2,1H3/t20-/m1/s1 |
| InChIKey | RAGWSZOLVMWLEV-HXUWFJFHSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|