C22H20FN5O2S — CID 151102361
2-[[(1S)-1-(2-fluoro-4-pyridinyl)ethyl]amino]-N-[2-(4-hydroxyphenyl)ethyl]thieno[3,2-d]pyrimidine-4-carboxamide (PubChem CID 151102361) has the molecular formula C22H20FN5O2S and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[[(1S)-1-(2-fluoro-4-pyridinyl)ethyl]amino]-N-[2-(4-hydroxyphenyl)ethyl]thieno[3,2-d]pyrimidine-4-carboxamide.
| Compound Name | 2-[[(1S)-1-(2-fluoro-4-pyridinyl)ethyl]amino]-N-[2-(4-hydroxyphenyl)ethyl]thieno[3,2-d]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 151102361 |
| Molecular Formula | C22H20FN5O2S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 2-[[(1S)-1-(2-fluoro-4-pyridinyl)ethyl]amino]-N-[2-(4-hydroxyphenyl)ethyl]thieno[3,2-d]pyrimidine-4-carboxamide |
| SMILES | C[C@H](Nc1nc(C(=O)NCCc2ccc(O)cc2)c2sccc2n1)c1ccnc(F)c1 |
| InChI | InChI=1S/C22H20FN5O2S/c1-13(15-7-10-24-18(23)12-15)26-22-27-17-8-11-31-20(17)19(28-22)21(30)25-9-6-14-2-4-16(29)5-3-14/h2-5,7-8,10-13,29H,6,9H2,1H3,(H,25,30)(H,26,27,28)/t13-/m0/s1 |
| InChIKey | MOJWNIQSBYXTRW-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|